C16H23NO2 — CID 79897837
N-(2,4-dimethylphenyl)-2,6-dioxaspiro[4.5]decan-9-amine (PubChem CID 79897837) has the molecular formula C16H23NO2 and a molecular weight of 261.36 g/mol. Its IUPAC name is N-(2,4-dimethylphenyl)-2,6-dioxaspiro[4.5]decan-9-amine.
| Compound Name | N-(2,4-dimethylphenyl)-2,6-dioxaspiro[4.5]decan-9-amine |
|---|---|
| PubChem CID | 79897837 |
| Molecular Formula | C16H23NO2 |
| Molecular Weight | 261.36 g/mol |
| Exact Mass | 261.17 |
| IUPAC Name | N-(2,4-dimethylphenyl)-2,6-dioxaspiro[4.5]decan-9-amine |
| SMILES | Cc1ccc(NC2CCOC3(CCOC3)C2)c(C)c1 |
| InChI | InChI=1S/C16H23NO2/c1-12-3-4-15(13(2)9-12)17-14-5-7-19-16(10-14)6-8-18-11-16/h3-4,9,14,17H,5-8,10-11H2,1-2H3 |
| InChIKey | LPCOPMCVZLRGAX-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.36 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |