C14H17ClINO2 — CID 107634963
N-(4-chloro-2-iodophenyl)-2,6-dioxaspiro[4.5]decan-9-amine (PubChem CID 107634963) has the molecular formula C14H17ClINO2 and a molecular weight of 393.65 g/mol. Its IUPAC name is N-(4-chloro-2-iodophenyl)-2,6-dioxaspiro[4.5]decan-9-amine.
| Compound Name | N-(4-chloro-2-iodophenyl)-2,6-dioxaspiro[4.5]decan-9-amine |
|---|---|
| PubChem CID | 107634963 |
| Molecular Formula | C14H17ClINO2 |
| Molecular Weight | 393.65 g/mol |
| Exact Mass | 393.00 |
| IUPAC Name | N-(4-chloro-2-iodophenyl)-2,6-dioxaspiro[4.5]decan-9-amine |
| SMILES | Clc1ccc(NC2CCOC3(CCOC3)C2)c(I)c1 |
| InChI | InChI=1S/C14H17ClINO2/c15-10-1-2-13(12(16)7-10)17-11-3-5-19-14(8-11)4-6-18-9-14/h1-2,7,11,17H,3-6,8-9H2 |
| InChIKey | PLDFRDQNJWNVEB-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.65 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|