C15H17ClF3NO — CID 79901887
N-[4-chloro-2-(trifluoromethyl)phenyl]-5-oxaspiro[3.5]nonan-8-amine (PubChem CID 79901887) has the molecular formula C15H17ClF3NO and a molecular weight of 319.75 g/mol. Its IUPAC name is N-[4-chloro-2-(trifluoromethyl)phenyl]-5-oxaspiro[3.5]nonan-8-amine.
| Compound Name | N-[4-chloro-2-(trifluoromethyl)phenyl]-5-oxaspiro[3.5]nonan-8-amine |
|---|---|
| PubChem CID | 79901887 |
| Molecular Formula | C15H17ClF3NO |
| Molecular Weight | 319.75 g/mol |
| Exact Mass | 319.10 |
| IUPAC Name | N-[4-chloro-2-(trifluoromethyl)phenyl]-5-oxaspiro[3.5]nonan-8-amine |
| SMILES | FC(F)(F)c1cc(Cl)ccc1NC1CCOC2(CCC2)C1 |
| InChI | InChI=1S/C15H17ClF3NO/c16-10-2-3-13(12(8-10)15(17,18)19)20-11-4-7-21-14(9-11)5-1-6-14/h2-3,8,11,20H,1,4-7,9H2 |
| InChIKey | VNYJZGSRZNLHOE-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.75 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |