C15H22N2O2 — CID 138684089
3-N-(2,6-dioxaspiro[4.5]decan-9-yl)-5-methylbenzene-1,3-diamine (PubChem CID 138684089) has the molecular formula C15H22N2O2 and a molecular weight of 262.35 g/mol. Its IUPAC name is 3-N-(2,6-dioxaspiro[4.5]decan-9-yl)-5-methylbenzene-1,3-diamine.
| Compound Name | 3-N-(2,6-dioxaspiro[4.5]decan-9-yl)-5-methylbenzene-1,3-diamine |
|---|---|
| PubChem CID | 138684089 |
| Molecular Formula | C15H22N2O2 |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.17 |
| IUPAC Name | 3-N-(2,6-dioxaspiro[4.5]decan-9-yl)-5-methylbenzene-1,3-diamine |
| SMILES | Cc1cc(N)cc(NC2CCOC3(CCOC3)C2)c1 |
| InChI | InChI=1S/C15H22N2O2/c1-11-6-12(16)8-14(7-11)17-13-2-4-19-15(9-13)3-5-18-10-15/h6-8,13,17H,2-5,9-10,16H2,1H3 |
| InChIKey | DHDMTZDYTIYLCA-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|