C10H14N2 — CID 112646925
3-N-cyclopropyl-5-methylbenzene-1,3-diamine (PubChem CID 112646925) has the molecular formula C10H14N2 and a molecular weight of 162.24 g/mol. Its IUPAC name is 3-N-cyclopropyl-5-methylbenzene-1,3-diamine.
| Compound Name | 3-N-cyclopropyl-5-methylbenzene-1,3-diamine |
|---|---|
| PubChem CID | 112646925 |
| Molecular Formula | C10H14N2 |
| Molecular Weight | 162.24 g/mol |
| Exact Mass | 162.12 |
| IUPAC Name | 3-N-cyclopropyl-5-methylbenzene-1,3-diamine |
| SMILES | Cc1cc(N)cc(NC2CC2)c1 |
| InChI | InChI=1S/C10H14N2/c1-7-4-8(11)6-10(5-7)12-9-2-3-9/h4-6,9,12H,2-3,11H2,1H3 |
| InChIKey | VNELOAVQPAYVBI-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.24 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|