C12H18N2O2S — CID 112647228
3-N-(1,1-dioxothian-4-yl)-5-methylbenzene-1,3-diamine (PubChem CID 112647228) has the molecular formula C12H18N2O2S and a molecular weight of 254.35 g/mol. Its IUPAC name is 3-N-(1,1-dioxothian-4-yl)-5-methylbenzene-1,3-diamine.
| Compound Name | 3-N-(1,1-dioxothian-4-yl)-5-methylbenzene-1,3-diamine |
|---|---|
| PubChem CID | 112647228 |
| Molecular Formula | C12H18N2O2S |
| Molecular Weight | 254.35 g/mol |
| Exact Mass | 254.11 |
| IUPAC Name | 3-N-(1,1-dioxothian-4-yl)-5-methylbenzene-1,3-diamine |
| SMILES | Cc1cc(N)cc(NC2CCS(=O)(=O)CC2)c1 |
| InChI | InChI=1S/C12H18N2O2S/c1-9-6-10(13)8-12(7-9)14-11-2-4-17(15,16)5-3-11/h6-8,11,14H,2-5,13H2,1H3 |
| InChIKey | BXRBBXIETYHRPC-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.35 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|