C11H14BrNO2S — CID 104939316
N-(3-bromo-5-methylphenyl)-1,1-dioxothiolan-3-amine (PubChem CID 104939316) has the molecular formula C11H14BrNO2S and a molecular weight of 304.21 g/mol. Its IUPAC name is N-(3-bromo-5-methylphenyl)-1,1-dioxothiolan-3-amine.
| Compound Name | N-(3-bromo-5-methylphenyl)-1,1-dioxothiolan-3-amine |
|---|---|
| PubChem CID | 104939316 |
| Molecular Formula | C11H14BrNO2S |
| Molecular Weight | 304.21 g/mol |
| Exact Mass | 302.99 |
| IUPAC Name | N-(3-bromo-5-methylphenyl)-1,1-dioxothiolan-3-amine |
| SMILES | Cc1cc(Br)cc(NC2CCS(=O)(=O)C2)c1 |
| InChI | InChI=1S/C11H14BrNO2S/c1-8-4-9(12)6-11(5-8)13-10-2-3-16(14,15)7-10/h4-6,10,13H,2-3,7H2,1H3 |
| InChIKey | RTNBPGNJXQVKBZ-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.21 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |