C14H18BrNO3S — CID 110426523
N-(3-bromo-5-methylphenyl)-3-(1,1-dioxothiolan-3-yl)propanamide (PubChem CID 110426523) has the molecular formula C14H18BrNO3S and a molecular weight of 360.27 g/mol. Its IUPAC name is N-(3-bromo-5-methylphenyl)-3-(1,1-dioxothiolan-3-yl)propanamide.
| Compound Name | N-(3-bromo-5-methylphenyl)-3-(1,1-dioxothiolan-3-yl)propanamide |
|---|---|
| PubChem CID | 110426523 |
| Molecular Formula | C14H18BrNO3S |
| Molecular Weight | 360.27 g/mol |
| Exact Mass | 359.02 |
| IUPAC Name | N-(3-bromo-5-methylphenyl)-3-(1,1-dioxothiolan-3-yl)propanamide |
| SMILES | Cc1cc(Br)cc(NC(=O)CCC2CCS(=O)(=O)C2)c1 |
| InChI | InChI=1S/C14H18BrNO3S/c1-10-6-12(15)8-13(7-10)16-14(17)3-2-11-4-5-20(18,19)9-11/h6-8,11H,2-5,9H2,1H3,(H,16,17) |
| InChIKey | QAQSZHVKUUCFKD-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.27 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |