C11H11BrF3NO — CID 104938592
N-(3-bromo-5-methylphenyl)-4,4,4-trifluorobutanamide (PubChem CID 104938592) has the molecular formula C11H11BrF3NO and a molecular weight of 310.11 g/mol. Its IUPAC name is N-(3-bromo-5-methylphenyl)-4,4,4-trifluorobutanamide.
| Compound Name | N-(3-bromo-5-methylphenyl)-4,4,4-trifluorobutanamide |
|---|---|
| PubChem CID | 104938592 |
| Molecular Formula | C11H11BrF3NO |
| Molecular Weight | 310.11 g/mol |
| Exact Mass | 309.00 |
| IUPAC Name | N-(3-bromo-5-methylphenyl)-4,4,4-trifluorobutanamide |
| SMILES | Cc1cc(Br)cc(NC(=O)CCC(F)(F)F)c1 |
| InChI | InChI=1S/C11H11BrF3NO/c1-7-4-8(12)6-9(5-7)16-10(17)2-3-11(13,14)15/h4-6H,2-3H2,1H3,(H,16,17) |
| InChIKey | CPUXMQZBDOCTHK-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.11 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |