C15H20ClNO5S — CID 110300542
N-(4-chloro-2,5-dimethoxyphenyl)-3-(1,1-dioxothiolan-3-yl)propanamide (PubChem CID 110300542) has the molecular formula C15H20ClNO5S and a molecular weight of 361.85 g/mol. Its IUPAC name is N-(4-chloro-2,5-dimethoxyphenyl)-3-(1,1-dioxothiolan-3-yl)propanamide.
| Compound Name | N-(4-chloro-2,5-dimethoxyphenyl)-3-(1,1-dioxothiolan-3-yl)propanamide |
|---|---|
| PubChem CID | 110300542 |
| Molecular Formula | C15H20ClNO5S |
| Molecular Weight | 361.85 g/mol |
| Exact Mass | 361.08 |
| IUPAC Name | N-(4-chloro-2,5-dimethoxyphenyl)-3-(1,1-dioxothiolan-3-yl)propanamide |
| SMILES | COc1cc(NC(=O)CCC2CCS(=O)(=O)C2)c(OC)cc1Cl |
| InChI | InChI=1S/C15H20ClNO5S/c1-21-13-8-12(14(22-2)7-11(13)16)17-15(18)4-3-10-5-6-23(19,20)9-10/h7-8,10H,3-6,9H2,1-2H3,(H,17,18) |
| InChIKey | SEPUOWKGDBWOGV-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.85 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |