C13H17BrN2O3S — CID 61058649
N-(4-bromophenyl)-2-[(1,1-dioxothiolan-3-yl)methylamino]acetamide (PubChem CID 61058649) has the molecular formula C13H17BrN2O3S and a molecular weight of 361.26 g/mol. Its IUPAC name is N-(4-bromophenyl)-2-[(1,1-dioxothiolan-3-yl)methylamino]acetamide.
| Compound Name | N-(4-bromophenyl)-2-[(1,1-dioxothiolan-3-yl)methylamino]acetamide |
|---|---|
| PubChem CID | 61058649 |
| Molecular Formula | C13H17BrN2O3S |
| Molecular Weight | 361.26 g/mol |
| Exact Mass | 360.01 |
| IUPAC Name | N-(4-bromophenyl)-2-[(1,1-dioxothiolan-3-yl)methylamino]acetamide |
| SMILES | O=C(CNCC1CCS(=O)(=O)C1)Nc1ccc(Br)cc1 |
| InChI | InChI=1S/C13H17BrN2O3S/c14-11-1-3-12(4-2-11)16-13(17)8-15-7-10-5-6-20(18,19)9-10/h1-4,10,15H,5-9H2,(H,16,17) |
| InChIKey | XHNITWSYBBNQIZ-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.26 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |