C10H10F3NO2S — CID 55118632
1,1-dioxo-N-(2,4,5-trifluorophenyl)thiolan-3-amine (PubChem CID 55118632) has the molecular formula C10H10F3NO2S and a molecular weight of 265.26 g/mol. Its IUPAC name is 1,1-dioxo-N-(2,4,5-trifluorophenyl)thiolan-3-amine.
| Compound Name | 1,1-dioxo-N-(2,4,5-trifluorophenyl)thiolan-3-amine |
|---|---|
| PubChem CID | 55118632 |
| Molecular Formula | C10H10F3NO2S |
| Molecular Weight | 265.26 g/mol |
| Exact Mass | 265.04 |
| IUPAC Name | 1,1-dioxo-N-(2,4,5-trifluorophenyl)thiolan-3-amine |
| SMILES | O=S1(=O)CCC(Nc2cc(F)c(F)cc2F)C1 |
| InChI | InChI=1S/C10H10F3NO2S/c11-7-3-9(13)10(4-8(7)12)14-6-1-2-17(15,16)5-6/h3-4,6,14H,1-2,5H2 |
| InChIKey | KTXVTSVFKDMMAJ-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.26 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|