C10H10BrF2NO2S — CID 43347704
N-(2-bromo-4,6-difluorophenyl)-1,1-dioxothiolan-3-amine (PubChem CID 43347704) has the molecular formula C10H10BrF2NO2S and a molecular weight of 326.16 g/mol. Its IUPAC name is N-(2-bromo-4,6-difluorophenyl)-1,1-dioxothiolan-3-amine.
| Compound Name | N-(2-bromo-4,6-difluorophenyl)-1,1-dioxothiolan-3-amine |
|---|---|
| PubChem CID | 43347704 |
| Molecular Formula | C10H10BrF2NO2S |
| Molecular Weight | 326.16 g/mol |
| Exact Mass | 324.96 |
| IUPAC Name | N-(2-bromo-4,6-difluorophenyl)-1,1-dioxothiolan-3-amine |
| SMILES | O=S1(=O)CCC(Nc2c(F)cc(F)cc2Br)C1 |
| InChI | InChI=1S/C10H10BrF2NO2S/c11-8-3-6(12)4-9(13)10(8)14-7-1-2-17(15,16)5-7/h3-4,7,14H,1-2,5H2 |
| InChIKey | CEZPVPARLMJCNZ-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.16 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |