C11H12BrF2NO4S2 — CID 60824231
2-bromo-N-(1,1-dioxothian-4-yl)-4,6-difluorobenzenesulfonamide (PubChem CID 60824231) has the molecular formula C11H12BrF2NO4S2 and a molecular weight of 404.25 g/mol. Its IUPAC name is 2-bromo-N-(1,1-dioxothian-4-yl)-4,6-difluorobenzenesulfonamide.
| Compound Name | 2-bromo-N-(1,1-dioxothian-4-yl)-4,6-difluorobenzenesulfonamide |
|---|---|
| PubChem CID | 60824231 |
| Molecular Formula | C11H12BrF2NO4S2 |
| Molecular Weight | 404.25 g/mol |
| Exact Mass | 402.94 |
| IUPAC Name | 2-bromo-N-(1,1-dioxothian-4-yl)-4,6-difluorobenzenesulfonamide |
| SMILES | O=S1(=O)CCC(NS(=O)(=O)c2c(F)cc(F)cc2Br)CC1 |
| InChI | InChI=1S/C11H12BrF2NO4S2/c12-9-5-7(13)6-10(14)11(9)21(18,19)15-8-1-3-20(16,17)4-2-8/h5-6,8,15H,1-4H2 |
| InChIKey | FMWHEJSPTDZXLZ-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.25 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |