C10H11F2NO4S2 — CID 110757609
N-(1,1-dioxothiolan-3-yl)-2,5-difluorobenzenesulfonamide (PubChem CID 110757609) has the molecular formula C10H11F2NO4S2 and a molecular weight of 311.33 g/mol. Its IUPAC name is N-(1,1-dioxothiolan-3-yl)-2,5-difluorobenzenesulfonamide.
| Compound Name | N-(1,1-dioxothiolan-3-yl)-2,5-difluorobenzenesulfonamide |
|---|---|
| PubChem CID | 110757609 |
| Molecular Formula | C10H11F2NO4S2 |
| Molecular Weight | 311.33 g/mol |
| Exact Mass | 311.01 |
| IUPAC Name | N-(1,1-dioxothiolan-3-yl)-2,5-difluorobenzenesulfonamide |
| SMILES | O=S1(=O)CCC(NS(=O)(=O)c2cc(F)ccc2F)C1 |
| InChI | InChI=1S/C10H11F2NO4S2/c11-7-1-2-9(12)10(5-7)19(16,17)13-8-3-4-18(14,15)6-8/h1-2,5,8,13H,3-4,6H2 |
| InChIKey | UNBIXYFNQHKAEL-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.33 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |