C14H20F2N2O2S — CID 43653555
N-[4-(ethylamino)cyclohexyl]-2,5-difluorobenzenesulfonamide (PubChem CID 43653555) has the molecular formula C14H20F2N2O2S and a molecular weight of 318.39 g/mol. Its IUPAC name is N-[4-(ethylamino)cyclohexyl]-2,5-difluorobenzenesulfonamide.
| Compound Name | N-[4-(ethylamino)cyclohexyl]-2,5-difluorobenzenesulfonamide |
|---|---|
| PubChem CID | 43653555 |
| Molecular Formula | C14H20F2N2O2S |
| Molecular Weight | 318.39 g/mol |
| Exact Mass | 318.12 |
| IUPAC Name | N-[4-(ethylamino)cyclohexyl]-2,5-difluorobenzenesulfonamide |
| SMILES | CCNC1CCC(NS(=O)(=O)c2cc(F)ccc2F)CC1 |
| InChI | InChI=1S/C14H20F2N2O2S/c1-2-17-11-4-6-12(7-5-11)18-21(19,20)14-9-10(15)3-8-13(14)16/h3,8-9,11-12,17-18H,2,4-7H2,1H3 |
| InChIKey | JSJRRUTVKYADOI-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.39 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |