C13H19F2N3O2S — CID 63632016
N-[1-(2-aminoethyl)piperidin-4-yl]-2,5-difluorobenzenesulfonamide (PubChem CID 63632016) has the molecular formula C13H19F2N3O2S and a molecular weight of 319.38 g/mol. Its IUPAC name is N-[1-(2-aminoethyl)piperidin-4-yl]-2,5-difluorobenzenesulfonamide.
| Compound Name | N-[1-(2-aminoethyl)piperidin-4-yl]-2,5-difluorobenzenesulfonamide |
|---|---|
| PubChem CID | 63632016 |
| Molecular Formula | C13H19F2N3O2S |
| Molecular Weight | 319.38 g/mol |
| Exact Mass | 319.12 |
| IUPAC Name | N-[1-(2-aminoethyl)piperidin-4-yl]-2,5-difluorobenzenesulfonamide |
| SMILES | NCCN1CCC(NS(=O)(=O)c2cc(F)ccc2F)CC1 |
| InChI | InChI=1S/C13H19F2N3O2S/c14-10-1-2-12(15)13(9-10)21(19,20)17-11-3-6-18(7-4-11)8-5-16/h1-2,9,11,17H,3-8,16H2 |
| InChIKey | VSPUHYAPDAVIOK-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.38 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |