C13H20ClN3O2S — CID 61125265
2-amino-4-chloro-N-(1-ethylpiperidin-4-yl)benzenesulfonamide (PubChem CID 61125265) has the molecular formula C13H20ClN3O2S and a molecular weight of 317.84 g/mol. Its IUPAC name is 2-amino-4-chloro-N-(1-ethylpiperidin-4-yl)benzenesulfonamide.
| Compound Name | 2-amino-4-chloro-N-(1-ethylpiperidin-4-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 61125265 |
| Molecular Formula | C13H20ClN3O2S |
| Molecular Weight | 317.84 g/mol |
| Exact Mass | 317.10 |
| IUPAC Name | 2-amino-4-chloro-N-(1-ethylpiperidin-4-yl)benzenesulfonamide |
| SMILES | CCN1CCC(NS(=O)(=O)c2ccc(Cl)cc2N)CC1 |
| InChI | InChI=1S/C13H20ClN3O2S/c1-2-17-7-5-11(6-8-17)16-20(18,19)13-4-3-10(14)9-12(13)15/h3-4,9,11,16H,2,5-8,15H2,1H3 |
| InChIKey | LNLCUDQTYFTRKO-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.84 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|