C12H18ClN3O2S — CID 61047090
2-chloro-N-(1-ethylpiperidin-4-yl)pyridine-4-sulfonamide (PubChem CID 61047090) has the molecular formula C12H18ClN3O2S and a molecular weight of 303.81 g/mol. Its IUPAC name is 2-chloro-N-(1-ethylpiperidin-4-yl)pyridine-4-sulfonamide.
| Compound Name | 2-chloro-N-(1-ethylpiperidin-4-yl)pyridine-4-sulfonamide |
|---|---|
| PubChem CID | 61047090 |
| Molecular Formula | C12H18ClN3O2S |
| Molecular Weight | 303.81 g/mol |
| Exact Mass | 303.08 |
| IUPAC Name | 2-chloro-N-(1-ethylpiperidin-4-yl)pyridine-4-sulfonamide |
| SMILES | CCN1CCC(NS(=O)(=O)c2ccnc(Cl)c2)CC1 |
| InChI | InChI=1S/C12H18ClN3O2S/c1-2-16-7-4-10(5-8-16)15-19(17,18)11-3-6-14-12(13)9-11/h3,6,9-10,15H,2,4-5,7-8H2,1H3 |
| InChIKey | OFNASHSEBLJCQY-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.81 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|