C18H30N2O2S — CID 22772586
N-(1-ethylpiperidin-4-yl)-2,3,4,5,6-pentamethylbenzenesulfonamide (PubChem CID 22772586) has the molecular formula C18H30N2O2S and a molecular weight of 338.52 g/mol. Its IUPAC name is N-(1-ethylpiperidin-4-yl)-2,3,4,5,6-pentamethylbenzenesulfonamide.
| Compound Name | N-(1-ethylpiperidin-4-yl)-2,3,4,5,6-pentamethylbenzenesulfonamide |
|---|---|
| PubChem CID | 22772586 |
| Molecular Formula | C18H30N2O2S |
| Molecular Weight | 338.52 g/mol |
| Exact Mass | 338.20 |
| IUPAC Name | N-(1-ethylpiperidin-4-yl)-2,3,4,5,6-pentamethylbenzenesulfonamide |
| SMILES | CCN1CCC(NS(=O)(=O)c2c(C)c(C)c(C)c(C)c2C)CC1 |
| InChI | InChI=1S/C18H30N2O2S/c1-7-20-10-8-17(9-11-20)19-23(21,22)18-15(5)13(3)12(2)14(4)16(18)6/h17,19H,7-11H2,1-6H3 |
| InChIKey | YPYOGWVIKISMQD-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.52 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |