C13H17F2NO2S — CID 64645531
2-(2,5-difluorophenyl)sulfonyl-N-ethylcyclopentan-1-amine (PubChem CID 64645531) has the molecular formula C13H17F2NO2S and a molecular weight of 289.35 g/mol. Its IUPAC name is 2-(2,5-difluorophenyl)sulfonyl-N-ethylcyclopentan-1-amine.
| Compound Name | 2-(2,5-difluorophenyl)sulfonyl-N-ethylcyclopentan-1-amine |
|---|---|
| PubChem CID | 64645531 |
| Molecular Formula | C13H17F2NO2S |
| Molecular Weight | 289.35 g/mol |
| Exact Mass | 289.09 |
| IUPAC Name | 2-(2,5-difluorophenyl)sulfonyl-N-ethylcyclopentan-1-amine |
| SMILES | CCNC1CCCC1S(=O)(=O)c1cc(F)ccc1F |
| InChI | InChI=1S/C13H17F2NO2S/c1-2-16-11-4-3-5-12(11)19(17,18)13-8-9(14)6-7-10(13)15/h6-8,11-12,16H,2-5H2,1H3 |
| InChIKey | YSOAOJWHBPUUBM-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.35 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |