C15H21ClFNO2S — CID 64674143
2-(3-chloro-4-fluorophenyl)sulfonyl-N-propylcyclohexan-1-amine (PubChem CID 64674143) has the molecular formula C15H21ClFNO2S and a molecular weight of 333.86 g/mol. Its IUPAC name is 2-(3-chloro-4-fluorophenyl)sulfonyl-N-propylcyclohexan-1-amine.
| Compound Name | 2-(3-chloro-4-fluorophenyl)sulfonyl-N-propylcyclohexan-1-amine |
|---|---|
| PubChem CID | 64674143 |
| Molecular Formula | C15H21ClFNO2S |
| Molecular Weight | 333.86 g/mol |
| Exact Mass | 333.10 |
| IUPAC Name | 2-(3-chloro-4-fluorophenyl)sulfonyl-N-propylcyclohexan-1-amine |
| SMILES | CCCNC1CCCCC1S(=O)(=O)c1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C15H21ClFNO2S/c1-2-9-18-14-5-3-4-6-15(14)21(19,20)11-7-8-13(17)12(16)10-11/h7-8,10,14-15,18H,2-6,9H2,1H3 |
| InChIKey | POWFTSRUQIJODB-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.86 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |