C15H21ClFNOS — CID 115477312
3-(3-chloro-4-fluorophenyl)sulfinyl-2-methyl-N-propylcyclopentan-1-amine (PubChem CID 115477312) has the molecular formula C15H21ClFNOS and a molecular weight of 317.86 g/mol. Its IUPAC name is 3-(3-chloro-4-fluorophenyl)sulfinyl-2-methyl-N-propylcyclopentan-1-amine.
| Compound Name | 3-(3-chloro-4-fluorophenyl)sulfinyl-2-methyl-N-propylcyclopentan-1-amine |
|---|---|
| PubChem CID | 115477312 |
| Molecular Formula | C15H21ClFNOS |
| Molecular Weight | 317.86 g/mol |
| Exact Mass | 317.10 |
| IUPAC Name | 3-(3-chloro-4-fluorophenyl)sulfinyl-2-methyl-N-propylcyclopentan-1-amine |
| SMILES | CCCNC1CCC(S(=O)c2ccc(F)c(Cl)c2)C1C |
| InChI | InChI=1S/C15H21ClFNOS/c1-3-8-18-14-6-7-15(10(14)2)20(19)11-4-5-13(17)12(16)9-11/h4-5,9-10,14-15,18H,3,6-8H2,1-2H3 |
| InChIKey | MTLAUOJMACRCDQ-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.86 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |