C16H23ClFNOS — CID 115477286
2-(3-chloro-4-fluorophenyl)sulfinyl-4-methyl-N-propylcyclohexan-1-amine (PubChem CID 115477286) has the molecular formula C16H23ClFNOS and a molecular weight of 331.88 g/mol. Its IUPAC name is 2-(3-chloro-4-fluorophenyl)sulfinyl-4-methyl-N-propylcyclohexan-1-amine.
| Compound Name | 2-(3-chloro-4-fluorophenyl)sulfinyl-4-methyl-N-propylcyclohexan-1-amine |
|---|---|
| PubChem CID | 115477286 |
| Molecular Formula | C16H23ClFNOS |
| Molecular Weight | 331.88 g/mol |
| Exact Mass | 331.12 |
| IUPAC Name | 2-(3-chloro-4-fluorophenyl)sulfinyl-4-methyl-N-propylcyclohexan-1-amine |
| SMILES | CCCNC1CCC(C)CC1S(=O)c1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C16H23ClFNOS/c1-3-8-19-15-7-4-11(2)9-16(15)21(20)12-5-6-14(18)13(17)10-12/h5-6,10-11,15-16,19H,3-4,7-9H2,1-2H3 |
| InChIKey | OOKYHSDTXOLXIF-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.88 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |