C17H26ClNOS — CID 64660130
2-(3-chlorophenyl)sulfinyl-4,4-dimethyl-N-propylcyclohexan-1-amine (PubChem CID 64660130) has the molecular formula C17H26ClNOS and a molecular weight of 327.92 g/mol. Its IUPAC name is 2-(3-chlorophenyl)sulfinyl-4,4-dimethyl-N-propylcyclohexan-1-amine.
| Compound Name | 2-(3-chlorophenyl)sulfinyl-4,4-dimethyl-N-propylcyclohexan-1-amine |
|---|---|
| PubChem CID | 64660130 |
| Molecular Formula | C17H26ClNOS |
| Molecular Weight | 327.92 g/mol |
| Exact Mass | 327.14 |
| IUPAC Name | 2-(3-chlorophenyl)sulfinyl-4,4-dimethyl-N-propylcyclohexan-1-amine |
| SMILES | CCCNC1CCC(C)(C)CC1S(=O)c1cccc(Cl)c1 |
| InChI | InChI=1S/C17H26ClNOS/c1-4-10-19-15-8-9-17(2,3)12-16(15)21(20)14-7-5-6-13(18)11-14/h5-7,11,15-16,19H,4,8-10,12H2,1-3H3 |
| InChIKey | MLORQVGDJWXQMU-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.92 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |