C15H21ClFNO2S — CID 79833106
6-(3-chloro-4-fluorophenyl)sulfonyl-N,2,2-trimethylcyclohexan-1-amine (PubChem CID 79833106) has the molecular formula C15H21ClFNO2S and a molecular weight of 333.86 g/mol. Its IUPAC name is 6-(3-chloro-4-fluorophenyl)sulfonyl-N,2,2-trimethylcyclohexan-1-amine.
| Compound Name | 6-(3-chloro-4-fluorophenyl)sulfonyl-N,2,2-trimethylcyclohexan-1-amine |
|---|---|
| PubChem CID | 79833106 |
| Molecular Formula | C15H21ClFNO2S |
| Molecular Weight | 333.86 g/mol |
| Exact Mass | 333.10 |
| IUPAC Name | 6-(3-chloro-4-fluorophenyl)sulfonyl-N,2,2-trimethylcyclohexan-1-amine |
| SMILES | CNC1C(S(=O)(=O)c2ccc(F)c(Cl)c2)CCCC1(C)C |
| InChI | InChI=1S/C15H21ClFNO2S/c1-15(2)8-4-5-13(14(15)18-3)21(19,20)10-6-7-12(17)11(16)9-10/h6-7,9,13-14,18H,4-5,8H2,1-3H3 |
| InChIKey | GCJUVXQNGUKYQM-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.86 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |