C14H19ClFNO2S — CID 64676122
2-(3-chloro-4-fluorophenyl)sulfonyl-N,4-dimethylcyclohexan-1-amine (PubChem CID 64676122) has the molecular formula C14H19ClFNO2S and a molecular weight of 319.83 g/mol. Its IUPAC name is 2-(3-chloro-4-fluorophenyl)sulfonyl-N,4-dimethylcyclohexan-1-amine.
| Compound Name | 2-(3-chloro-4-fluorophenyl)sulfonyl-N,4-dimethylcyclohexan-1-amine |
|---|---|
| PubChem CID | 64676122 |
| Molecular Formula | C14H19ClFNO2S |
| Molecular Weight | 319.83 g/mol |
| Exact Mass | 319.08 |
| IUPAC Name | 2-(3-chloro-4-fluorophenyl)sulfonyl-N,4-dimethylcyclohexan-1-amine |
| SMILES | CNC1CCC(C)CC1S(=O)(=O)c1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C14H19ClFNO2S/c1-9-3-6-13(17-2)14(7-9)20(18,19)10-4-5-12(16)11(15)8-10/h4-5,8-9,13-14,17H,3,6-7H2,1-2H3 |
| InChIKey | FAAFPBAXBMIAKP-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.83 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |