C13H18FNO2S — CID 64903866
3-(4-fluorophenyl)sulfonyl-N,2-dimethylcyclopentan-1-amine (PubChem CID 64903866) has the molecular formula C13H18FNO2S and a molecular weight of 271.36 g/mol. Its IUPAC name is 3-(4-fluorophenyl)sulfonyl-N,2-dimethylcyclopentan-1-amine.
| Compound Name | 3-(4-fluorophenyl)sulfonyl-N,2-dimethylcyclopentan-1-amine |
|---|---|
| PubChem CID | 64903866 |
| Molecular Formula | C13H18FNO2S |
| Molecular Weight | 271.36 g/mol |
| Exact Mass | 271.10 |
| IUPAC Name | 3-(4-fluorophenyl)sulfonyl-N,2-dimethylcyclopentan-1-amine |
| SMILES | CNC1CCC(S(=O)(=O)c2ccc(F)cc2)C1C |
| InChI | InChI=1S/C13H18FNO2S/c1-9-12(15-2)7-8-13(9)18(16,17)11-5-3-10(14)4-6-11/h3-6,9,12-13,15H,7-8H2,1-2H3 |
| InChIKey | KGMLYNIQWAYZCP-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.36 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |