C11H14FNO2S — CID 174917383
(3S)-3-(4-fluorophenyl)sulfonyl-2-methylpyrrolidine (PubChem CID 174917383) has the molecular formula C11H14FNO2S and a molecular weight of 243.30 g/mol. Its IUPAC name is (3S)-3-(4-fluorophenyl)sulfonyl-2-methylpyrrolidine.
| Compound Name | (3S)-3-(4-fluorophenyl)sulfonyl-2-methylpyrrolidine |
|---|---|
| PubChem CID | 174917383 |
| Molecular Formula | C11H14FNO2S |
| Molecular Weight | 243.30 g/mol |
| Exact Mass | 243.07 |
| IUPAC Name | (3S)-3-(4-fluorophenyl)sulfonyl-2-methylpyrrolidine |
| SMILES | CC1NCC[C@@H]1S(=O)(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C11H14FNO2S/c1-8-11(6-7-13-8)16(14,15)10-4-2-9(12)3-5-10/h2-5,8,11,13H,6-7H2,1H3/t8?,11-/m0/s1 |
| InChIKey | WJBHEOAFPZIZLQ-LYNSQETBSA-N |
| XLogP | 1.35 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.30 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |