C16H25NO2S — CID 79847566
6-(benzenesulfonyl)-N-ethyl-2,2-dimethylcyclohexan-1-amine (PubChem CID 79847566) has the molecular formula C16H25NO2S and a molecular weight of 295.45 g/mol. Its IUPAC name is 6-(benzenesulfonyl)-N-ethyl-2,2-dimethylcyclohexan-1-amine.
| Compound Name | 6-(benzenesulfonyl)-N-ethyl-2,2-dimethylcyclohexan-1-amine |
|---|---|
| PubChem CID | 79847566 |
| Molecular Formula | C16H25NO2S |
| Molecular Weight | 295.45 g/mol |
| Exact Mass | 295.16 |
| IUPAC Name | 6-(benzenesulfonyl)-N-ethyl-2,2-dimethylcyclohexan-1-amine |
| SMILES | CCNC1C(S(=O)(=O)c2ccccc2)CCCC1(C)C |
| InChI | InChI=1S/C16H25NO2S/c1-4-17-15-14(11-8-12-16(15,2)3)20(18,19)13-9-6-5-7-10-13/h5-7,9-10,14-15,17H,4,8,11-12H2,1-3H3 |
| InChIKey | HTEKGIFHAOFYRZ-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.45 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |