C16H31NO2S — CID 79847934
6-cyclopentylsulfonyl-2,2-dimethyl-N-propylcyclohexan-1-amine (PubChem CID 79847934) has the molecular formula C16H31NO2S and a molecular weight of 301.50 g/mol. Its IUPAC name is 6-cyclopentylsulfonyl-2,2-dimethyl-N-propylcyclohexan-1-amine.
| Compound Name | 6-cyclopentylsulfonyl-2,2-dimethyl-N-propylcyclohexan-1-amine |
|---|---|
| PubChem CID | 79847934 |
| Molecular Formula | C16H31NO2S |
| Molecular Weight | 301.50 g/mol |
| Exact Mass | 301.21 |
| IUPAC Name | 6-cyclopentylsulfonyl-2,2-dimethyl-N-propylcyclohexan-1-amine |
| SMILES | CCCNC1C(S(=O)(=O)C2CCCC2)CCCC1(C)C |
| InChI | InChI=1S/C16H31NO2S/c1-4-12-17-15-14(10-7-11-16(15,2)3)20(18,19)13-8-5-6-9-13/h13-15,17H,4-12H2,1-3H3 |
| InChIKey | DUJHSURGGMQPMR-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.50 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |