C14H29NO2S — CID 79863450
5-butylsulfonyl-2,2-dimethyl-N-propylcyclopentan-1-amine (PubChem CID 79863450) has the molecular formula C14H29NO2S and a molecular weight of 275.46 g/mol. Its IUPAC name is 5-butylsulfonyl-2,2-dimethyl-N-propylcyclopentan-1-amine.
| Compound Name | 5-butylsulfonyl-2,2-dimethyl-N-propylcyclopentan-1-amine |
|---|---|
| PubChem CID | 79863450 |
| Molecular Formula | C14H29NO2S |
| Molecular Weight | 275.46 g/mol |
| Exact Mass | 275.19 |
| IUPAC Name | 5-butylsulfonyl-2,2-dimethyl-N-propylcyclopentan-1-amine |
| SMILES | CCCCS(=O)(=O)C1CCC(C)(C)C1NCCC |
| InChI | InChI=1S/C14H29NO2S/c1-5-7-11-18(16,17)12-8-9-14(3,4)13(12)15-10-6-2/h12-13,15H,5-11H2,1-4H3 |
| InChIKey | VUSIJPISSXXUKO-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.46 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |