About 5-butylsulfonyl-2,2-dimethyl-N-propylcyclopentan-1-amine
5-butylsulfonyl-2,2-dimethyl-N-propylcyclopentan-1-amine (PubChem CID 79863450) has the molecular formula C14H29NO2S
and a molecular weight of 275.46 g/mol. Its IUPAC name is 5-butylsulfonyl-2,2-dimethyl-N-propylcyclopentan-1-amine.
Molecular Properties
| Compound Name | 5-butylsulfonyl-2,2-dimethyl-N-propylcyclopentan-1-amine |
| PubChem CID | 79863450 |
| Molecular Formula | C14H29NO2S |
| Molecular Weight | 275.46 g/mol |
| Exact Mass | 275.19 |
| IUPAC Name | 5-butylsulfonyl-2,2-dimethyl-N-propylcyclopentan-1-amine |
| SMILES | CCCCS(=O)(=O)C1CCC(C)(C)C1NCCC |
| InChI | InChI=1S/C14H29NO2S/c1-5-7-11-18(16,17)12-8-9-14(3,4)13(12)15-10-6-2/h12-13,15H,5-11H2,1-4H3 |
| InChIKey | VUSIJPISSXXUKO-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.46 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-butylsulfonyl-2,2-dimethyl-N-propylcyclopentan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-butylsulfonyl-2,2-dimethyl-N-propylcyclopentan-1-amine?
The IUPAC name of 5-butylsulfonyl-2,2-dimethyl-N-propylcyclopentan-1-amine (CID 79863450) is 5-butylsulfonyl-2,2-dimethyl-N-propylcyclopentan-1-amine.
What is the SMILES notation for 5-butylsulfonyl-2,2-dimethyl-N-propylcyclopentan-1-amine?
The canonical SMILES for 5-butylsulfonyl-2,2-dimethyl-N-propylcyclopentan-1-amine is CCCCS(=O)(=O)C1CCC(C)(C)C1NCCC.
What is the InChIKey of 5-butylsulfonyl-2,2-dimethyl-N-propylcyclopentan-1-amine?
The InChIKey is VUSIJPISSXXUKO-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H29NO2S/c1-5-7-11-18(16,17)12-8-9-14(3,4)13(12)15-10-6-2/h12-13,15H,5-11H2,1-4H3.
What are the key properties of 5-butylsulfonyl-2,2-dimethyl-N-propylcyclopentan-1-amine?
5-butylsulfonyl-2,2-dimethyl-N-propylcyclopentan-1-amine has a molecular weight of 275.46 g/mol, XLogP of 2.76, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-butylsulfonyl-2,2-dimethyl-N-propylcyclopentan-1-amine is sourced from PubChem (CID 79863450), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).