C15H29NO3S — CID 79862414
2,2-dimethyl-5-(oxan-4-ylsulfonyl)-N-propylcyclopentan-1-amine (PubChem CID 79862414) has the molecular formula C15H29NO3S and a molecular weight of 303.47 g/mol. Its IUPAC name is 2,2-dimethyl-5-(oxan-4-ylsulfonyl)-N-propylcyclopentan-1-amine.
| Compound Name | 2,2-dimethyl-5-(oxan-4-ylsulfonyl)-N-propylcyclopentan-1-amine |
|---|---|
| PubChem CID | 79862414 |
| Molecular Formula | C15H29NO3S |
| Molecular Weight | 303.47 g/mol |
| Exact Mass | 303.19 |
| IUPAC Name | 2,2-dimethyl-5-(oxan-4-ylsulfonyl)-N-propylcyclopentan-1-amine |
| SMILES | CCCNC1C(S(=O)(=O)C2CCOCC2)CCC1(C)C |
| InChI | InChI=1S/C15H29NO3S/c1-4-9-16-14-13(5-8-15(14,2)3)20(17,18)12-6-10-19-11-7-12/h12-14,16H,4-11H2,1-3H3 |
| InChIKey | SGAJXYMLPJGJAE-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.47 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |