C10H13FN2O4S2 — CID 63321949
3-amino-N-(1,1-dioxothiolan-3-yl)-5-fluorobenzenesulfonamide (PubChem CID 63321949) has the molecular formula C10H13FN2O4S2 and a molecular weight of 308.36 g/mol. Its IUPAC name is 3-amino-N-(1,1-dioxothiolan-3-yl)-5-fluorobenzenesulfonamide.
| Compound Name | 3-amino-N-(1,1-dioxothiolan-3-yl)-5-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 63321949 |
| Molecular Formula | C10H13FN2O4S2 |
| Molecular Weight | 308.36 g/mol |
| Exact Mass | 308.03 |
| IUPAC Name | 3-amino-N-(1,1-dioxothiolan-3-yl)-5-fluorobenzenesulfonamide |
| SMILES | Nc1cc(F)cc(S(=O)(=O)NC2CCS(=O)(=O)C2)c1 |
| InChI | InChI=1S/C10H13FN2O4S2/c11-7-3-8(12)5-10(4-7)19(16,17)13-9-1-2-18(14,15)6-9/h3-5,9,13H,1-2,6,12H2 |
| InChIKey | SUXYUUNVFBHURU-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 106.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.36 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|