C13H19NO4S2 — CID 45154252
N-(1,1-dioxothiolan-3-yl)-2,4,6-trimethylbenzenesulfonamide (PubChem CID 45154252) has the molecular formula C13H19NO4S2 and a molecular weight of 317.43 g/mol. Its IUPAC name is N-(1,1-dioxothiolan-3-yl)-2,4,6-trimethylbenzenesulfonamide.
| Compound Name | N-(1,1-dioxothiolan-3-yl)-2,4,6-trimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 45154252 |
| Molecular Formula | C13H19NO4S2 |
| Molecular Weight | 317.43 g/mol |
| Exact Mass | 317.08 |
| IUPAC Name | N-(1,1-dioxothiolan-3-yl)-2,4,6-trimethylbenzenesulfonamide |
| SMILES | Cc1cc(C)c(S(=O)(=O)NC2CCS(=O)(=O)C2)c(C)c1 |
| InChI | InChI=1S/C13H19NO4S2/c1-9-6-10(2)13(11(3)7-9)20(17,18)14-12-4-5-19(15,16)8-12/h6-7,12,14H,4-5,8H2,1-3H3 |
| InChIKey | XXGHEXQRYGAXFL-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.43 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |