C9H15N3O4S2 — CID 43237040
N-(1,1-dioxothiolan-3-yl)-3,5-dimethyl-1H-pyrazole-4-sulfonamide (PubChem CID 43237040) has the molecular formula C9H15N3O4S2 and a molecular weight of 293.37 g/mol. Its IUPAC name is N-(1,1-dioxothiolan-3-yl)-3,5-dimethyl-1H-pyrazole-4-sulfonamide.
| Compound Name | N-(1,1-dioxothiolan-3-yl)-3,5-dimethyl-1H-pyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 43237040 |
| Molecular Formula | C9H15N3O4S2 |
| Molecular Weight | 293.37 g/mol |
| Exact Mass | 293.05 |
| IUPAC Name | N-(1,1-dioxothiolan-3-yl)-3,5-dimethyl-1H-pyrazole-4-sulfonamide |
| SMILES | Cc1n[nH]c(C)c1S(=O)(=O)NC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C9H15N3O4S2/c1-6-9(7(2)11-10-6)18(15,16)12-8-3-4-17(13,14)5-8/h8,12H,3-5H2,1-2H3,(H,10,11) |
| InChIKey | ZKLBVKVCJMDUCJ-UHFFFAOYSA-N |
| XLogP | -0.51 |
| TPSA | 108.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.37 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |