About 3,5-dimethyl-N-(3-methyl-1,1-dioxothiolan-3-yl)-1H-pyrazole-4-sulfonamide
3,5-dimethyl-N-(3-methyl-1,1-dioxothiolan-3-yl)-1H-pyrazole-4-sulfonamide (PubChem CID 60700277) has the molecular formula C10H17N3O4S2
and a molecular weight of 307.40 g/mol. Its IUPAC name is 3,5-dimethyl-N-(3-methyl-1,1-dioxothiolan-3-yl)-1H-pyrazole-4-sulfonamide.
Molecular Properties
| Compound Name | 3,5-dimethyl-N-(3-methyl-1,1-dioxothiolan-3-yl)-1H-pyrazole-4-sulfonamide |
| PubChem CID | 60700277 |
| Molecular Formula | C10H17N3O4S2 |
| Molecular Weight | 307.40 g/mol |
| Exact Mass | 307.07 |
| IUPAC Name | 3,5-dimethyl-N-(3-methyl-1,1-dioxothiolan-3-yl)-1H-pyrazole-4-sulfonamide |
| SMILES | Cc1n[nH]c(C)c1S(=O)(=O)NC1(C)CCS(=O)(=O)C1 |
| InChI | InChI=1S/C10H17N3O4S2/c1-7-9(8(2)12-11-7)19(16,17)13-10(3)4-5-18(14,15)6-10/h13H,4-6H2,1-3H3,(H,11,12) |
| InChIKey | QTIGCPACRVUUBU-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 108.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 307.40 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3,5-dimethyl-N-(3-methyl-1,1-dioxothiolan-3-yl)-1H-pyrazole-4-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-dimethyl-N-(3-methyl-1,1-dioxothiolan-3-yl)-1H-pyrazole-4-sulfonamide?
The IUPAC name of 3,5-dimethyl-N-(3-methyl-1,1-dioxothiolan-3-yl)-1H-pyrazole-4-sulfonamide (CID 60700277) is 3,5-dimethyl-N-(3-methyl-1,1-dioxothiolan-3-yl)-1H-pyrazole-4-sulfonamide.
What is the SMILES notation for 3,5-dimethyl-N-(3-methyl-1,1-dioxothiolan-3-yl)-1H-pyrazole-4-sulfonamide?
The canonical SMILES for 3,5-dimethyl-N-(3-methyl-1,1-dioxothiolan-3-yl)-1H-pyrazole-4-sulfonamide is Cc1n[nH]c(C)c1S(=O)(=O)NC1(C)CCS(=O)(=O)C1.
What is the InChIKey of 3,5-dimethyl-N-(3-methyl-1,1-dioxothiolan-3-yl)-1H-pyrazole-4-sulfonamide?
The InChIKey is QTIGCPACRVUUBU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17N3O4S2/c1-7-9(8(2)12-11-7)19(16,17)13-10(3)4-5-18(14,15)6-10/h13H,4-6H2,1-3H3,(H,11,12).
What are the key properties of 3,5-dimethyl-N-(3-methyl-1,1-dioxothiolan-3-yl)-1H-pyrazole-4-sulfonamide?
3,5-dimethyl-N-(3-methyl-1,1-dioxothiolan-3-yl)-1H-pyrazole-4-sulfonamide has a molecular weight of 307.40 g/mol, XLogP of -0.12, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-dimethyl-N-(3-methyl-1,1-dioxothiolan-3-yl)-1H-pyrazole-4-sulfonamide is sourced from PubChem (CID 60700277), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).