C13H19NO4S2 — CID 51642152
4-ethyl-N-[(3S)-3-methyl-1,1-dioxothiolan-3-yl]benzenesulfonamide (PubChem CID 51642152) has the molecular formula C13H19NO4S2 and a molecular weight of 317.43 g/mol. Its IUPAC name is 4-ethyl-N-[(3S)-3-methyl-1,1-dioxothiolan-3-yl]benzenesulfonamide.
| Compound Name | 4-ethyl-N-[(3S)-3-methyl-1,1-dioxothiolan-3-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 51642152 |
| Molecular Formula | C13H19NO4S2 |
| Molecular Weight | 317.43 g/mol |
| Exact Mass | 317.08 |
| IUPAC Name | 4-ethyl-N-[(3S)-3-methyl-1,1-dioxothiolan-3-yl]benzenesulfonamide |
| SMILES | CCc1ccc(S(=O)(=O)N[C@@]2(C)CCS(=O)(=O)C2)cc1 |
| InChI | InChI=1S/C13H19NO4S2/c1-3-11-4-6-12(7-5-11)20(17,18)14-13(2)8-9-19(15,16)10-13/h4-7,14H,3,8-10H2,1-2H3/t13-/m0/s1 |
| InChIKey | ADWFRKFLUWMNKW-ZDUSSCGKSA-N |
| XLogP | 1.10 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.43 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |