C10H14N2O4S2 — CID 47331328
N-(3-methyl-1,1-dioxothiolan-3-yl)pyridine-3-sulfonamide (PubChem CID 47331328) has the molecular formula C10H14N2O4S2 and a molecular weight of 290.37 g/mol. Its IUPAC name is N-(3-methyl-1,1-dioxothiolan-3-yl)pyridine-3-sulfonamide.
| Compound Name | N-(3-methyl-1,1-dioxothiolan-3-yl)pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 47331328 |
| Molecular Formula | C10H14N2O4S2 |
| Molecular Weight | 290.37 g/mol |
| Exact Mass | 290.04 |
| IUPAC Name | N-(3-methyl-1,1-dioxothiolan-3-yl)pyridine-3-sulfonamide |
| SMILES | CC1(NS(=O)(=O)c2cccnc2)CCS(=O)(=O)C1 |
| InChI | InChI=1S/C10H14N2O4S2/c1-10(4-6-17(13,14)8-10)12-18(15,16)9-3-2-5-11-7-9/h2-3,5,7,12H,4,6,8H2,1H3 |
| InChIKey | GQEIVVKYQFCPSE-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 93.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.37 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |