C12H16N4O2S — CID 61124758
N-(4-cyano-1-methylpiperidin-4-yl)pyridine-3-sulfonamide (PubChem CID 61124758) has the molecular formula C12H16N4O2S and a molecular weight of 280.35 g/mol. Its IUPAC name is N-(4-cyano-1-methylpiperidin-4-yl)pyridine-3-sulfonamide.
| Compound Name | N-(4-cyano-1-methylpiperidin-4-yl)pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 61124758 |
| Molecular Formula | C12H16N4O2S |
| Molecular Weight | 280.35 g/mol |
| Exact Mass | 280.10 |
| IUPAC Name | N-(4-cyano-1-methylpiperidin-4-yl)pyridine-3-sulfonamide |
| SMILES | CN1CCC(C#N)(NS(=O)(=O)c2cccnc2)CC1 |
| InChI | InChI=1S/C12H16N4O2S/c1-16-7-4-12(10-13,5-8-16)15-19(17,18)11-3-2-6-14-9-11/h2-3,6,9,15H,4-5,7-8H2,1H3 |
| InChIKey | NPPAZNMHJRWYFL-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 86.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.35 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |