C10H12Cl2N2O4S2 — CID 64608959
5,6-dichloro-N-(3-methyl-1,1-dioxothiolan-3-yl)pyridine-3-sulfonamide (PubChem CID 64608959) has the molecular formula C10H12Cl2N2O4S2 and a molecular weight of 359.26 g/mol. Its IUPAC name is 5,6-dichloro-N-(3-methyl-1,1-dioxothiolan-3-yl)pyridine-3-sulfonamide.
| Compound Name | 5,6-dichloro-N-(3-methyl-1,1-dioxothiolan-3-yl)pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 64608959 |
| Molecular Formula | C10H12Cl2N2O4S2 |
| Molecular Weight | 359.26 g/mol |
| Exact Mass | 357.96 |
| IUPAC Name | 5,6-dichloro-N-(3-methyl-1,1-dioxothiolan-3-yl)pyridine-3-sulfonamide |
| SMILES | CC1(NS(=O)(=O)c2cnc(Cl)c(Cl)c2)CCS(=O)(=O)C1 |
| InChI | InChI=1S/C10H12Cl2N2O4S2/c1-10(2-3-19(15,16)6-10)14-20(17,18)7-4-8(11)9(12)13-5-7/h4-5,14H,2-3,6H2,1H3 |
| InChIKey | VHPIWOMPTNQELB-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 93.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.26 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|