C11H14ClFN2O4S2 — CID 103051221
3-amino-5-chloro-2-fluoro-N-(3-methyl-1,1-dioxothiolan-3-yl)benzenesulfonamide (PubChem CID 103051221) has the molecular formula C11H14ClFN2O4S2 and a molecular weight of 356.83 g/mol. Its IUPAC name is 3-amino-5-chloro-2-fluoro-N-(3-methyl-1,1-dioxothiolan-3-yl)benzenesulfonamide.
| Compound Name | 3-amino-5-chloro-2-fluoro-N-(3-methyl-1,1-dioxothiolan-3-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 103051221 |
| Molecular Formula | C11H14ClFN2O4S2 |
| Molecular Weight | 356.83 g/mol |
| Exact Mass | 356.01 |
| IUPAC Name | 3-amino-5-chloro-2-fluoro-N-(3-methyl-1,1-dioxothiolan-3-yl)benzenesulfonamide |
| SMILES | CC1(NS(=O)(=O)c2cc(Cl)cc(N)c2F)CCS(=O)(=O)C1 |
| InChI | InChI=1S/C11H14ClFN2O4S2/c1-11(2-3-20(16,17)6-11)15-21(18,19)9-5-7(12)4-8(14)10(9)13/h4-5,15H,2-3,6,14H2,1H3 |
| InChIKey | KTAAIIMMRLKUFR-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 106.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.83 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|