About 2-chloro-N-(3-methyl-1,1-dioxothiolan-3-yl)-5-methylsulfonylthiophene-3-sulfonamide
2-chloro-N-(3-methyl-1,1-dioxothiolan-3-yl)-5-methylsulfonylthiophene-3-sulfonamide (PubChem CID 75440460) has the molecular formula C10H14ClNO6S4
and a molecular weight of 407.94 g/mol. Its IUPAC name is 2-chloro-N-(3-methyl-1,1-dioxothiolan-3-yl)-5-methylsulfonylthiophene-3-sulfonamide.
Molecular Properties
| Compound Name | 2-chloro-N-(3-methyl-1,1-dioxothiolan-3-yl)-5-methylsulfonylthiophene-3-sulfonamide |
| PubChem CID | 75440460 |
| Molecular Formula | C10H14ClNO6S4 |
| Molecular Weight | 407.94 g/mol |
| Exact Mass | 406.94 |
| IUPAC Name | 2-chloro-N-(3-methyl-1,1-dioxothiolan-3-yl)-5-methylsulfonylthiophene-3-sulfonamide |
| SMILES | CC1(NS(=O)(=O)c2cc(S(C)(=O)=O)sc2Cl)CCS(=O)(=O)C1 |
| InChI | InChI=1S/C10H14ClNO6S4/c1-10(3-4-21(15,16)6-10)12-22(17,18)7-5-8(19-9(7)11)20(2,13)14/h5,12H,3-4,6H2,1-2H3 |
| InChIKey | RLSSVNQBZHOJKX-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 114.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 407.94 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 2-chloro-N-(3-methyl-1,1-dioxothiolan-3-yl)-5-methylsulfonylthiophene-3-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-N-(3-methyl-1,1-dioxothiolan-3-yl)-5-methylsulfonylthiophene-3-sulfonamide?
The IUPAC name of 2-chloro-N-(3-methyl-1,1-dioxothiolan-3-yl)-5-methylsulfonylthiophene-3-sulfonamide (CID 75440460) is 2-chloro-N-(3-methyl-1,1-dioxothiolan-3-yl)-5-methylsulfonylthiophene-3-sulfonamide.
What is the SMILES notation for 2-chloro-N-(3-methyl-1,1-dioxothiolan-3-yl)-5-methylsulfonylthiophene-3-sulfonamide?
The canonical SMILES for 2-chloro-N-(3-methyl-1,1-dioxothiolan-3-yl)-5-methylsulfonylthiophene-3-sulfonamide is CC1(NS(=O)(=O)c2cc(S(C)(=O)=O)sc2Cl)CCS(=O)(=O)C1.
What is the InChIKey of 2-chloro-N-(3-methyl-1,1-dioxothiolan-3-yl)-5-methylsulfonylthiophene-3-sulfonamide?
The InChIKey is RLSSVNQBZHOJKX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14ClNO6S4/c1-10(3-4-21(15,16)6-10)12-22(17,18)7-5-8(19-9(7)11)20(2,13)14/h5,12H,3-4,6H2,1-2H3.
What are the key properties of 2-chloro-N-(3-methyl-1,1-dioxothiolan-3-yl)-5-methylsulfonylthiophene-3-sulfonamide?
2-chloro-N-(3-methyl-1,1-dioxothiolan-3-yl)-5-methylsulfonylthiophene-3-sulfonamide has a molecular weight of 407.94 g/mol, XLogP of 0.66, 4 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-N-(3-methyl-1,1-dioxothiolan-3-yl)-5-methylsulfonylthiophene-3-sulfonamide is sourced from PubChem (CID 75440460), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).