C13H22N4O2S2 — CID 61122478
1-[(3,5-dimethyl-1H-pyrazol-4-yl)sulfonylamino]cycloheptane-1-carbothioamide (PubChem CID 61122478) has the molecular formula C13H22N4O2S2 and a molecular weight of 330.48 g/mol. Its IUPAC name is 1-[(3,5-dimethyl-1H-pyrazol-4-yl)sulfonylamino]cycloheptane-1-carbothioamide.
| Compound Name | 1-[(3,5-dimethyl-1H-pyrazol-4-yl)sulfonylamino]cycloheptane-1-carbothioamide |
|---|---|
| PubChem CID | 61122478 |
| Molecular Formula | C13H22N4O2S2 |
| Molecular Weight | 330.48 g/mol |
| Exact Mass | 330.12 |
| IUPAC Name | 1-[(3,5-dimethyl-1H-pyrazol-4-yl)sulfonylamino]cycloheptane-1-carbothioamide |
| SMILES | Cc1n[nH]c(C)c1S(=O)(=O)NC1(C(N)=S)CCCCCC1 |
| InChI | InChI=1S/C13H22N4O2S2/c1-9-11(10(2)16-15-9)21(18,19)17-13(12(14)20)7-5-3-4-6-8-13/h17H,3-8H2,1-2H3,(H2,14,20)(H,15,16) |
| InChIKey | NHQJVLCASLKTHF-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 100.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.48 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|