C6H13N3O2S2 — CID 114959145
1-(sulfamoylamino)cyclopentane-1-carbothioamide (PubChem CID 114959145) has the molecular formula C6H13N3O2S2 and a molecular weight of 223.32 g/mol. Its IUPAC name is 1-(sulfamoylamino)cyclopentane-1-carbothioamide.
| Compound Name | 1-(sulfamoylamino)cyclopentane-1-carbothioamide |
|---|---|
| PubChem CID | 114959145 |
| Molecular Formula | C6H13N3O2S2 |
| Molecular Weight | 223.32 g/mol |
| Exact Mass | 223.04 |
| IUPAC Name | 1-(sulfamoylamino)cyclopentane-1-carbothioamide |
| SMILES | NC(=S)C1(NS(N)(=O)=O)CCCC1 |
| InChI | InChI=1S/C6H13N3O2S2/c7-5(12)6(3-1-2-4-6)9-13(8,10)11/h9H,1-4H2,(H2,7,12)(H2,8,10,11) |
| InChIKey | BHYBPQFCWVFTCS-UHFFFAOYSA-N |
| XLogP | -0.62 |
| TPSA | 98.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.32 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|