C8H18N4O2S — CID 114959695
1-(sulfamoylamino)cycloheptane-1-carboximidamide (PubChem CID 114959695) has the molecular formula C8H18N4O2S and a molecular weight of 234.32 g/mol. Its IUPAC name is 1-(sulfamoylamino)cycloheptane-1-carboximidamide.
| Compound Name | 1-(sulfamoylamino)cycloheptane-1-carboximidamide |
|---|---|
| PubChem CID | 114959695 |
| Molecular Formula | C8H18N4O2S |
| Molecular Weight | 234.32 g/mol |
| Exact Mass | 234.12 |
| IUPAC Name | 1-(sulfamoylamino)cycloheptane-1-carboximidamide |
| SMILES | [H]/N=C(\N)C1(NS(N)(=O)=O)CCCCCC1 |
| InChI | InChI=1S/C8H18N4O2S/c9-7(10)8(12-15(11,13)14)5-3-1-2-4-6-8/h12H,1-6H2,(H3,9,10)(H2,11,13,14) |
| InChIKey | JKRYHUZFTDSRAS-UHFFFAOYSA-N |
| XLogP | -0.19 |
| TPSA | 122.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.32 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|