C12H24N4O2S — CID 114813298
1-(cyclopropylsulfamoylamino)cyclooctane-1-carboximidamide (PubChem CID 114813298) has the molecular formula C12H24N4O2S and a molecular weight of 288.42 g/mol. Its IUPAC name is 1-(cyclopropylsulfamoylamino)cyclooctane-1-carboximidamide.
| Compound Name | 1-(cyclopropylsulfamoylamino)cyclooctane-1-carboximidamide |
|---|---|
| PubChem CID | 114813298 |
| Molecular Formula | C12H24N4O2S |
| Molecular Weight | 288.42 g/mol |
| Exact Mass | 288.16 |
| IUPAC Name | 1-(cyclopropylsulfamoylamino)cyclooctane-1-carboximidamide |
| SMILES | [H]/N=C(\N)C1(NS(=O)(=O)NC2CC2)CCCCCCC1 |
| InChI | InChI=1S/C12H24N4O2S/c13-11(14)12(8-4-2-1-3-5-9-12)16-19(17,18)15-10-6-7-10/h10,15-16H,1-9H2,(H3,13,14) |
| InChIKey | XSJWJXUXEPPIGB-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 108.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.42 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|