C14H27N3O2S — CID 105361944
1-(cyclopentylsulfonylamino)-4-ethylcyclohexane-1-carboximidamide (PubChem CID 105361944) has the molecular formula C14H27N3O2S and a molecular weight of 301.46 g/mol. Its IUPAC name is 1-(cyclopentylsulfonylamino)-4-ethylcyclohexane-1-carboximidamide.
| Compound Name | 1-(cyclopentylsulfonylamino)-4-ethylcyclohexane-1-carboximidamide |
|---|---|
| PubChem CID | 105361944 |
| Molecular Formula | C14H27N3O2S |
| Molecular Weight | 301.46 g/mol |
| Exact Mass | 301.18 |
| IUPAC Name | 1-(cyclopentylsulfonylamino)-4-ethylcyclohexane-1-carboximidamide |
| SMILES | [H]/N=C(\N)C1(NS(=O)(=O)C2CCCC2)CCC(CC)CC1 |
| InChI | InChI=1S/C14H27N3O2S/c1-2-11-7-9-14(10-8-11,13(15)16)17-20(18,19)12-5-3-4-6-12/h11-12,17H,2-10H2,1H3,(H3,15,16) |
| InChIKey | PAGDHAJKRBXMOH-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 96.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.46 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|