C10H21N3O2S — CID 105361960
2-(cyclopentylsulfonylamino)-2-methylbutanimidamide (PubChem CID 105361960) has the molecular formula C10H21N3O2S and a molecular weight of 247.36 g/mol. Its IUPAC name is 2-(cyclopentylsulfonylamino)-2-methylbutanimidamide.
| Compound Name | 2-(cyclopentylsulfonylamino)-2-methylbutanimidamide |
|---|---|
| PubChem CID | 105361960 |
| Molecular Formula | C10H21N3O2S |
| Molecular Weight | 247.36 g/mol |
| Exact Mass | 247.14 |
| IUPAC Name | 2-(cyclopentylsulfonylamino)-2-methylbutanimidamide |
| SMILES | [H]/N=C(\N)C(C)(CC)NS(=O)(=O)C1CCCC1 |
| InChI | InChI=1S/C10H21N3O2S/c1-3-10(2,9(11)12)13-16(14,15)8-6-4-5-7-8/h8,13H,3-7H2,1-2H3,(H3,11,12) |
| InChIKey | GFLPEEBJXZEFHV-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 96.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.36 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|