C11H23N3O3S — CID 112738058
2-methyl-2-[(1-methylsulfonylpiperidin-4-yl)amino]butanamide (PubChem CID 112738058) has the molecular formula C11H23N3O3S and a molecular weight of 277.39 g/mol. Its IUPAC name is 2-methyl-2-[(1-methylsulfonylpiperidin-4-yl)amino]butanamide.
| Compound Name | 2-methyl-2-[(1-methylsulfonylpiperidin-4-yl)amino]butanamide |
|---|---|
| PubChem CID | 112738058 |
| Molecular Formula | C11H23N3O3S |
| Molecular Weight | 277.39 g/mol |
| Exact Mass | 277.15 |
| IUPAC Name | 2-methyl-2-[(1-methylsulfonylpiperidin-4-yl)amino]butanamide |
| SMILES | CCC(C)(NC1CCN(S(C)(=O)=O)CC1)C(N)=O |
| InChI | InChI=1S/C11H23N3O3S/c1-4-11(2,10(12)15)13-9-5-7-14(8-6-9)18(3,16)17/h9,13H,4-8H2,1-3H3,(H2,12,15) |
| InChIKey | XMEGNWOSACBRDE-UHFFFAOYSA-N |
| XLogP | -0.35 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.39 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |